Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BPN14770 is a selective phosphodiesterase 4D (PDE4D) allosteric inhibitor with IC50s of 7.8 nM and 7.4 nM for PDE4D7 and PDE4D3, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A18663 |
|---|---|
| Formula | C21H15ClF3NO2 |
| Molecular Weight | 405.8 |
| CAS Number | 1606974-33-7 |
| SMILES | O=C(O)CC1=CC=C(CC2=CC(C3=CC=CC(Cl)=C3)=NC(C(F)(F)F)=C2)C=C1 |
| Synonyms | BPN 14770, BPN-14770 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 71 mg/mL (174.96 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 71 mg/mL (174.96 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.64 mL | 123.21 mL | 246.43 mL |
| 0.5 mM | 4.93 mL | 24.64 mL | 49.29 mL |
| 1 mM | 2.46 mL | 12.32 mL | 24.64 mL |
| 5 mM | 0.49 mL | 2.46 mL | 4.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
