Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | BQR-695, also known as NVP-BQR695, is a PI4KIIIβ inhibitor with IC50s of 80 and 3.5 nM for human PI4KIIIβ and Plasmodium variant of PI4KIIIβ, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16938 |
|---|---|
| Formula | C19H20N4O3 |
| Molecular Weight | 352.39 |
| CAS Number | 1513879-21-4 |
| SMILES | O=C(NC)CNC1=NC2=CC(C3=CC=C(OC)C(OC)=C3)=CC=C2N=C1 |
| Synonyms | NVP-BQR695, NVP-BQR-695, NVP-BQR 695, BQR-695, BQR 695 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (178.78 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (8.51 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.38 mL | 141.89 mL | 283.78 mL |
| 0.5 mM | 5.68 mL | 28.38 mL | 56.76 mL |
| 1 mM | 2.84 mL | 14.19 mL | 28.38 mL |
| 5 mM | 0.57 mL | 2.84 mL | 5.68 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
