Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Brigatinib (AP26113) is a potent and selective ALK (IC50, 0.6 nM) and ROS1 (IC50, 0.9 nM) inhibitor. It also inhibits ROS1, FLT3, and mutant variants of FLT3 (D835Y) and EGFR with lower potentcy. |
|---|
| Catalog Num | A13450 |
|---|---|
| Formula | C29H39ClN7O2P |
| Molecular Weight | 584.09 |
| CAS Number | 1197953-54-0 |
| SMILES | CN1CCN(CC1)C2CCN(CC2)C3=CC(=C(C=C3)NC4=NC=C(C(=N4)NC5=CC=CC=C5P(=O)(C)C)Cl)OC |
| Synonyms | AP-26113, AP 26113, AP26113 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 1 mg/mL (1.71 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 39 mg/mL (66.76 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.12 mL | 85.6 mL | 171.21 mL |
| 0.5 mM | 3.42 mL | 17.12 mL | 34.24 mL |
| 1 mM | 1.71 mL | 8.56 mL | 17.12 mL |
| 5 mM | 0.34 mL | 1.71 mL | 3.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
