Loading distributor info...
| Description | BRL 54443 is a 5-HT1E and 5-HT1F receptor agonist with pKi of 8.7 and 9.25, respectively, with a weak binding affinity for 5-HT1A, 5-HT1B, 5-HT1D receptors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15592 |
|---|---|
| Formula | C14H18N2O |
| Molecular Weight | 230.31 |
| CAS Number | 57477-39-1 |
| SMILES | CN1CCC(CC1)C2=CNC3=C2C=C(C=C3)O |
| Synonyms | BRL54443, BRL 54443 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 40 mg/mL (173.68 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (8.68 mM) | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.42 mL | 217.1 mL | 434.2 mL |
| 0.5 mM | 8.68 mL | 43.42 mL | 86.84 mL |
| 1 mM | 4.34 mL | 21.71 mL | 43.42 mL |
| 5 mM | 0.87 mL | 4.34 mL | 8.68 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
