Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | C-DIM12 is a novel synthetic activator of Nurr1. C-DIM12 induces dopaminergic gene expression and protects against 6-hydroxydopamine neurotoxicity in vitro. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15936 |
|---|---|
| Formula | C23H17ClN2 |
| Molecular Weight | 356.85 |
| CAS Number | 178946-89-9 |
| SMILES | ClC1=CC=C(C(C2=CNC3=C2C=CC=C3)C4=CNC5=C4C=CC=C5)C=C1 |
| Synonyms | C-DIM 12, C-DIM-12 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (170.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 61 mg/mL (170.94 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.02 mL | 140.11 mL | 280.23 mL |
| 0.5 mM | 5.6 mL | 28.02 mL | 56.05 mL |
| 1 mM | 2.8 mL | 14.01 mL | 28.02 mL |
| 5 mM | 0.56 mL | 2.8 mL | 5.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
