Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Caffeic acid phenethyl ester is a potent and specific inhibitor of NF-κB activation | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13698 |
|---|---|
| Formula | C17H16O4 |
| Molecular Weight | 284.31 |
| CAS Number | 104594-70-9 |
| SMILES | C1=CC=C(C=C1)CCOC(=O)/C=C/C2=CC(=C(C=C2)O)O |
| Synonyms | CAPE, Phenylethyl Caffeate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (193.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 55 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.17 mL | 175.86 mL | 351.73 mL |
| 0.5 mM | 7.03 mL | 35.17 mL | 70.35 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.17 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
