Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CCF642 is a novel PDI-inhibiting compound with antimyeloma activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16122 |
|---|---|
| Formula | C15H10N2O4S3 |
| Molecular Weight | 378.45 |
| CAS Number | 346640-08-2 |
| SMILES | COC1=CC=C(C=C1)N2C(=O)C(=CC3=CC=C(S3)[N+](=O)[O-])SC2=S |
| Synonyms | CCF 642, CCF-642 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (36.99 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.42 mL | 132.12 mL | 264.24 mL |
| 0.5 mM | 5.28 mL | 26.42 mL | 52.85 mL |
| 1 mM | 2.64 mL | 13.21 mL | 26.42 mL |
| 5 mM | 0.53 mL | 2.64 mL | 5.28 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
