Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CCG-203971 is an inhibitor of SRE activation in the prostate cancer cell line PC-3 (IC50 = 6.4 μM), with 87% inhibition of SRE activation achieved at 100 μM. |
|---|
| Catalog Num | A16928 |
|---|---|
| Formula | C23H21ClN2O3 |
| Molecular Weight | 408.88 |
| CAS Number | 1443437-74-8 |
| SMILES | O=C(C1CN(C(C2=CC=CC(C3=CC=CO3)=C2)=O)CCC1)NC4=CC=C(Cl)C=C4 |
| Synonyms | CCG203971, CCG 203971 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 72 mg/mL (176.09 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (9.78 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.46 mL | 122.29 mL | 244.57 mL |
| 0.5 mM | 4.89 mL | 24.46 mL | 48.91 mL |
| 1 mM | 2.45 mL | 12.23 mL | 24.46 mL |
| 5 mM | 0.49 mL | 2.45 mL | 4.89 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
