Loading distributor info...
| Description | CDK2-IN-4 is a potent and selective CDK2 inhibitor with an IC50 of 44 nM for CDK2/cyclin A, shows 2,000-fold selectivity over CDK1/cyclin B (IC50=86 uM). | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A18667 |
|---|---|
| Formula | C23H18N6O2S |
| Molecular Weight | 442.49 |
| CAS Number | 2079895-42-2 |
| SMILES | O=S(C1=CC=C(C=C1)NC2=NC3=NC=NC3=C(C4=CC(C5=CC=CC=C5)=CC=C4)N2)(N)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 77 mg/mL (174.01 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.6 mL | 113 mL | 225.99 mL |
| 0.5 mM | 4.52 mL | 22.6 mL | 45.2 mL |
| 1 mM | 2.26 mL | 11.3 mL | 22.6 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.52 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
