Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cephalexin hydrate is an semisynthetic cephalosporin antibiotic with antimicrobial activity similar to that of CEPHALORIDINE or CEPHALOTHIN, but somewhat less potent. It is effective against both gram-positive and gram-negative organisms. |
|---|
| Catalog Num | A18109 |
|---|---|
| Formula | C16H19N3O5S |
| Molecular Weight | 365.4 |
| CAS Number | 23325-78-2 |
| SMILES | [H]O[H].O=C(C(N12)=C(C)CS[C@@]2([H])[C@@H](NC(C(N)C3=CC=CC=C3)=O)C1=O)O |
| Synonyms | Cephalexin hydrate; Cefalival; Cefibacter |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 0.01 mg/mL (0.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.37 mL | 136.84 mL | 273.67 mL |
| 0.5 mM | 5.47 mL | 27.37 mL | 54.73 mL |
| 1 mM | 2.74 mL | 13.68 mL | 27.37 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
