Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Chlormadinone acetate is a steroidal progestin with additional antiandrogen and antigonadotropic effects, used often in combinations as an oral contraceptive. |
|---|
| Catalog Num | A16443 |
|---|---|
| Formula | C23H29ClO4 |
| Molecular Weight | 404.93 |
| CAS Number | 302-22-7 |
| SMILES | CC([C@@]1(OC(C)=O)CC[C@@]2([H])[C@]([C@]3([H])CC[C@@]21C)([H])C=C(Cl)C4=CC(CC[C@]34C)=O)=O |
| Synonyms | Gestafortin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 24 mg/mL (59.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 1 mg/mL (2.46 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.7 mL | 123.48 mL | 246.96 mL |
| 0.5 mM | 4.94 mL | 24.7 mL | 49.39 mL |
| 1 mM | 2.47 mL | 12.35 mL | 24.7 mL |
| 5 mM | 0.49 mL | 2.47 mL | 4.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
