Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CHS-828 is a potent inhibitor of NAD+ biosynthesis enzyme NAMPT with IC50 <25 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12515 |
|---|---|
| Formula | C19H22ClN5O |
| Molecular Weight | 371.86 |
| CAS Number | 200484-11-3 |
| SMILES | ClC1=CC=C(OCCCCCC/N=C(\N=C2C=CNC=C/2)NC#N)C=C1 |
| Synonyms | GMX1778, GMX-1778, GMX 1778, CHS828, CHS 828 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (172.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.89 mL | 134.46 mL | 268.92 mL |
| 0.5 mM | 5.38 mL | 26.89 mL | 53.78 mL |
| 1 mM | 2.69 mL | 13.45 mL | 26.89 mL |
| 5 mM | 0.54 mL | 2.69 mL | 5.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
