Loading distributor info...
| Description | Cilengitide is a cyclic Arg-Gly-Asp peptide with potential antineoplastic activity. Cilengitide binds to and inhibits the activities of the alpha(v)beta(3) and alpha(v)beta(5) integrins, thereby inhibiting endothelial cell-cell interactions, endothelial cell-matrix interactions, and angiogenesis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12371 |
|---|---|
| Formula | C29H41N8O9F3 |
| Molecular Weight | 702.7 |
| CAS Number | 199807-35-7 |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@@H](C(=O)N1C)Cc2ccccc2)CC(=O)O)CCCNC(=N)N.C(=O)(C(F)(F)F)O |
| Synonyms | EMD 12197,EMD-85189,EMD-121974,NSC-707544,D03497 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (126.66 mM) | |
| Water | 7 mg/mL (9.96 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 14.23 mL | 71.15 mL | 142.31 mL |
| 0.5 mM | 2.85 mL | 14.23 mL | 28.46 mL |
| 1 mM | 1.42 mL | 7.12 mL | 14.23 mL |
| 5 mM | 0.28 mL | 1.42 mL | 2.85 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
