Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Ciproxifan maleate is a potent, selective H3 histamine receptor antagonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11117 |
|---|---|
| Formula | C20H22N2O6 |
| Molecular Weight | 386.4 |
| CAS Number | 184025-19-2 |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)OCCCC3=CN=CN3.C(=C\C(=O)O)\C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (137.16 mM) | |
| Water | 1 mg/mL (2.58 mM) | ||
| Ethanol | 53 mg/mL (137.16 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.88 mL | 129.4 mL | 258.8 mL |
| 0.5 mM | 5.18 mL | 25.88 mL | 51.76 mL |
| 1 mM | 2.59 mL | 12.94 mL | 25.88 mL |
| 5 mM | 0.52 mL | 2.59 mL | 5.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
