Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | cis-(Z)-Flupentixol dihydrochloride is a dopamine receptor antagonist, antipsychotic, neuroleptic agent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12347 |
|---|---|
| Formula | C23H25F3N2OS.2HCl |
| Molecular Weight | 507.44 |
| CAS Number | 51529-01-2 |
| SMILES | C1CN(CCN1CC/C=C\2/C3=CC=CC=C3SC4=C2C=C(C=C4)C(F)(F)F)CCO.Cl.Cl |
| Synonyms | Flupentixol dihydrochloride |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 85 mg/mL (167.5 mM) | |
| Water | 85 mg/mL (167.5 mM) | ||
| Ethanol | 26 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.71 mL | 98.53 mL | 197.07 mL |
| 0.5 mM | 3.94 mL | 19.71 mL | 39.41 mL |
| 1 mM | 1.97 mL | 9.85 mL | 19.71 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
