Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Clozapine N-oxide is a major metabolite of Clozapine noted to decrease SR-2A (5-HT2 serotonin receptor) density in vitro. |
|---|
| Catalog Num | A15048 |
|---|---|
| Formula | C18H19ClN4O |
| Molecular Weight | 342.82 |
| CAS Number | 34233-69-7 |
| SMILES | C[N+]1(CCN(CC1)C2=C3C=CC=CC3=NC4=C(N2)C=C(C=C4)Cl)[O-] |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (183.77 mM) | |
| Water | 63 mg/mL (183.77 mM) | ||
| Ethanol | 7 mg/mL (20.41 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.17 mL | 145.85 mL | 291.7 mL |
| 0.5 mM | 5.83 mL | 29.17 mL | 58.34 mL |
| 1 mM | 2.92 mL | 14.58 mL | 29.17 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
