Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CPI-360 is a selective EZH2 inhibitor with IC50 values of 0.5 and 2.5 nM for wild-type EZH2 and Y641N mutant EZH2, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15908 |
|---|---|
| Formula | C25H31N3O4 |
| Molecular Weight | 437.53 |
| CAS Number | 1802175-06-9 |
| SMILES | CC(N1)=CC(OC)=C(CNC(C2=C(C)N([C@H](C)C3CCOCC3)C4=C2C=CC=C4)=O)C1=O |
| Synonyms | CPI360, CPI 360 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 18 mg/mL (41.14 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 16 mg/mL (36.57 mM) | ||
| In vivo | 10% DMSO+60% PEG 400+ddH2O | 19 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.28 mL | 228.56 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.71 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
