Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CRT-0066101, potent inhibitor of protein kinase D (PKD); inhibits all PKD isoforms (IC50 values are 1, 2 and 2.5 nM for PKD1, PKD3 and PKD2 respectively). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16318 |
|---|---|
| Formula | C18H22N6O.2HCl |
| Molecular Weight | 411.33 |
| CAS Number | 1883545-60-5 |
| SMILES | Cl.Cl.Cn1cc(cn1)c3cc(c2nc(NC[C@H](N)CC)ccn2)c(O)cc3 |
| Synonyms | CRT 0066101, CRT0066101 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 25 mg/mL (60.77 mM) | |
| Water | 80 mg/mL (194.49 mM) | ||
| Ethanol | Warmed: 2 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.31 mL | 121.56 mL | 243.11 mL |
| 0.5 mM | 4.86 mL | 24.31 mL | 48.62 mL |
| 1 mM | 2.43 mL | 12.16 mL | 24.31 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
