Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | CU-CPT22 is a potent protein complex of toll-like receptor 1 and 2 (TLR1/2) inhibitor. |
|---|
| Catalog Num | A20148 |
|---|---|
| Formula | C19H22O7 |
| Molecular Weight | 362.37 |
| CAS Number | 1416324-85-0 |
| SMILES | O=C(C(C=C1O)=CC2=CC(OC)=C(O)C(O)=C2C1=O)OCCCCCC |
| Synonyms | CU-CPT 22; CU-CPT-22; CUCPT22; CUCPT 22; CUCPT-22 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (187.65 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (22.07 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.6 mL | 137.98 mL | 275.96 mL |
| 0.5 mM | 5.52 mL | 27.6 mL | 55.19 mL |
| 1 mM | 2.76 mL | 13.8 mL | 27.6 mL |
| 5 mM | 0.55 mL | 2.76 mL | 5.52 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
