Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Cyclobenzaprine HCl is a muscle relaxant by blocking pain sensations. |
|---|
| Catalog Num | A14255 |
|---|---|
| Formula | C20H22ClN |
| Molecular Weight | 311.85 |
| CAS Number | 6202-23-9 |
| SMILES | CN(C)CCC=C1C2=CC=CC=C2C=CC3=CC=CC=C31.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (195.6 mM) | |
| Water | 61 mg/mL (195.6 mM) | ||
| Ethanol | 61 mg/mL (195.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.07 mL | 160.33 mL | 320.67 mL |
| 0.5 mM | 6.41 mL | 32.07 mL | 64.13 mL |
| 1 mM | 3.21 mL | 16.03 mL | 32.07 mL |
| 5 mM | 0.64 mL | 3.21 mL | 6.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
