Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Danirixin is a selective, and reversible CXCR2 antagonist, with IC50?of?12.5 nM for CXCL8. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20792 |
|---|---|
| Formula | C19H21ClFN3O4S |
| Molecular Weight | 441.9 |
| CAS Number | 954126-98-8 |
| SMILES | O=C(NC1=CC=C(Cl)C(S([C@H]2CCCNC2)(=O)=O)=C1O)NC3=C(C)C(F)=CC=C3 |
| Synonyms | GSK1325756, GSK 1325756, GSK-1325756 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 87 mg/mL (196.88 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.63 mL | 113.15 mL | 226.3 mL |
| 0.5 mM | 4.53 mL | 22.63 mL | 45.26 mL |
| 1 mM | 2.26 mL | 11.31 mL | 22.63 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
