Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Deferasirox is a rationally-designed oral iron chelator, also a cytochrome P450 3A4 inducer, Cytochrome P450 2C8 inhibitor, and Cytochrome P450 1A2 inhibitor. |
|---|
| Catalog Num | A10293 |
|---|---|
| Formula | C21H15N3O4 |
| Molecular Weight | 373.36 |
| CAS Number | 201530-41-8 |
| SMILES | C1=C/C(=C\2/N/C(=C\3/C=CC=CC3=O)/N(N2)C4=CC=C(C=C4)C(=O)O)/C(=O)C=C1 |
| Synonyms | ICL-670, ICL-670A, CGP-72670 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 64 mg/mL (171.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL | ||
| In vivo | 5% DMSO+40% PEG 300+5%Tween 80 +50 % H2O | 3.5 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.78 mL | 133.92 mL | 267.84 mL |
| 0.5 mM | 5.36 mL | 26.78 mL | 53.57 mL |
| 1 mM | 2.68 mL | 13.39 mL | 26.78 mL |
| 5 mM | 0.54 mL | 2.68 mL | 5.36 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
