Loading distributor info...
| Description | Dihydroactinidiolide, existing in plant leaves and fruits, is a potent plant growth inhibitor, a regulator of gene expression and is responsible for photo acclimation in Arabidopsis. |
|---|
| Catalog Num | A12142 |
|---|---|
| Formula | C11H16O2 |
| Molecular Weight | 180.24 |
| CAS Number | 17092-92-1 |
| SMILES | O=C1O[C@@]2(C)C(C(C)(C)CCC2)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (194.18 mM) | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 55.48 mL | 277.41 mL | 554.82 mL |
| 0.5 mM | 11.1 mL | 55.48 mL | 110.96 mL |
| 1 mM | 5.55 mL | 27.74 mL | 55.48 mL |
| 5 mM | 1.11 mL | 5.55 mL | 11.1 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
