Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Dihydrotanshinone I, isolated from Salvia miltiorrhiza, exhibited cytotoxicity against various tumor cell lines. |
|---|
| Catalog Num | A14563 |
|---|---|
| Formula | C18H14O3 |
| Molecular Weight | 278.3 |
| CAS Number | 87205-99-0 |
| SMILES | CC1COC2=C1C(=O)C(=O)C3=C2C=CC4=C3C=CC=C4C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 3 mg/mL (10.78 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.93 mL | 179.66 mL | 359.32 mL |
| 0.5 mM | 7.19 mL | 35.93 mL | 71.86 mL |
| 1 mM | 3.59 mL | 17.97 mL | 35.93 mL |
| 5 mM | 0.72 mL | 3.59 mL | 7.19 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
