Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | DKM 2-93 is a relatively selective inhibitor of UBA5 with an IC50 of 430 μM. |
|---|
| Catalog Num | A20114 |
|---|---|
| Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 |
| CAS Number | 65836-72-8 |
| SMILES | O=C(NCC1=CC=C(OC)C(OC)=C1)CCl |
| Synonyms | DKM-2-93, DKM2-93 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 48 mg/mL (196.97 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (57.45 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.04 mL | 205.18 mL | 410.36 mL |
| 0.5 mM | 8.21 mL | 41.04 mL | 82.07 mL |
| 1 mM | 4.1 mL | 20.52 mL | 41.04 mL |
| 5 mM | 0.82 mL | 4.1 mL | 8.21 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
