Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Elexacaftor (VX-445, Compound 1) is a modulator of cystic fibrosis transmembrane conductance regulator (CFTR). |
|---|
| Catalog Num | A20094 |
|---|---|
| Formula | C26H34F3N7O4S |
| Molecular Weight | 597.65 |
| CAS Number | 2216712-66-0 |
| SMILES | CC1(C)C[C@H](C)CN1C2=C(C(NS(C3=CN(C)N=C3C)(=O)=O)=O)C=CC(N4C=CC(OCC(C)(C(F)(F)F)C)=N4)=N2 |
| Synonyms | VX-445, VX445?? |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (165.65 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.73 mL | 83.66 mL | 167.32 mL |
| 0.5 mM | 3.35 mL | 16.73 mL | 33.46 mL |
| 1 mM | 1.67 mL | 8.37 mL | 16.73 mL |
| 5 mM | 0.33 mL | 1.67 mL | 3.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
