Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | ELN484228 is a cell-permeable alpha-Synuclein Blocker. |
|---|
| Catalog Num | A17071 |
|---|---|
| Formula | C12H10FNO2S |
| Molecular Weight | 251.27 |
| CAS Number | 312-63-0 |
| SMILES | O=S(C1=CC=CC=C1)(NC2=CC=C(F)C=C2)=O |
| Synonyms | ELN-484228, ELN 484228 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (179.08 mM) | |
| Water | Insoluble | ||
| Ethanol | 45 mg/mL (179.08 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.8 mL | 198.99 mL | 397.98 mL |
| 0.5 mM | 7.96 mL | 39.8 mL | 79.6 mL |
| 1 mM | 3.98 mL | 19.9 mL | 39.8 mL |
| 5 mM | 0.8 mL | 3.98 mL | 7.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
