Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Empagliflozin is a potent, selective sodium glucose co-transporter-2 inhibitor that is in development for the treatment of type 2 diabetes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12440 |
|---|---|
| Formula | C23H27ClO7 |
| Molecular Weight | 450.91 |
| CAS Number | 864070-44-0 |
| SMILES | C1COC[C@H]1OC2=CC=C(C=C2)CC3=C(C=CC(=C3)[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 88 mg/mL (195.15 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 15% Captisol | 14 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.18 mL | 110.89 mL | 221.77 mL |
| 0.5 mM | 4.44 mL | 22.18 mL | 44.35 mL |
| 1 mM | 2.22 mL | 11.09 mL | 22.18 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
