Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | ENMD-2076 has selective activity against Aurora A and Flt3 with IC50 of 14 nM and 1.86 nM, 25-fold selective for Aurora A than over Aurora B and less potent to VEGFR2/KDR and VEGFR3, FGFR1 and FGFR2 and PDGFRα. Phase 2. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10352 |
|---|---|
| Formula | C21H25N7 |
| Molecular Weight | 375.5 |
| CAS Number | 934353-76-1, 1291074-87-7 |
| SMILES | CC1=CC(=NN1)NC2=NC(=NC(=C2)N3CCN(CC3)C)/C=C/C4=CC=CC=C4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 101 mg/mL (268.99 mM) | |
| Water | 1 mg/mL (2.66 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | 0.5% CMC+0.25% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.63 mL | 133.16 mL | 266.31 mL |
| 0.5 mM | 5.33 mL | 26.63 mL | 53.26 mL |
| 1 mM | 2.66 mL | 13.32 mL | 26.63 mL |
| 5 mM | 0.53 mL | 2.66 mL | 5.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
