Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Eriodictyol is a bitter-masking flavanone, a flavonoid extracted from Yerba Santa (Eriodictyon californicum), a plant native to North America. |
|---|
| Catalog Num | A12052 |
|---|---|
| Formula | C15H12O6 |
| Molecular Weight | 288.25 |
| CAS Number | 552-58-9 |
| SMILES | C1[C@H](OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
| Synonyms | Eriodictiol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 52 mg/mL (180.39 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.69 mL | 173.46 mL | 346.92 mL |
| 0.5 mM | 6.94 mL | 34.69 mL | 69.38 mL |
| 1 mM | 3.47 mL | 17.35 mL | 34.69 mL |
| 5 mM | 0.69 mL | 3.47 mL | 6.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
