Loading distributor info...
| Description | ERK5-IN-2 is an orally active, sub-micromolar, selective ERK5 inhibitor with IC50s of 0.82 μM, 3 μM for ERK5 and ERK5 MEF2D, respectively. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A18871 |
|---|---|
| Formula | C17H11BrFN3O2 |
| Molecular Weight | 388.19 |
| CAS Number | 1888305-96-1 |
| SMILES | FC1=CC=CC(Br)=C1C(C2=CNC(C(NC3=CC=CN=C3)=O)=C2)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (170.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 3 mg/mL (7.72 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.76 mL | 128.8 mL | 257.61 mL |
| 0.5 mM | 5.15 mL | 25.76 mL | 51.52 mL |
| 1 mM | 2.58 mL | 12.88 mL | 25.76 mL |
| 5 mM | 0.52 mL | 2.58 mL | 5.15 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
