Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ethyl vanillin acetate is acectate form of ethyl vanillin. Ethyl vanillin acetate is a flavorant used in chocolate or candy. |
|---|
| Catalog Num | A19644 |
|---|---|
| Formula | C11H12O4 |
| Molecular Weight | 208.21 |
| CAS Number | 72207-94-4 |
| SMILES | O=CC1=CC=C(OC(C)=O)C(OCC)=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (168.09 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.03 mL | 240.14 mL | 480.28 mL |
| 0.5 mM | 9.61 mL | 48.03 mL | 96.06 mL |
| 1 mM | 4.8 mL | 24.01 mL | 48.03 mL |
| 5 mM | 0.96 mL | 4.8 mL | 9.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
