Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | FDI-6 is an inhibitor of FOXM1. FDI-6 binds directly to FOXM1 protein, to displace FOXM1 from genomic targets in MCF-7 breast cancer cells, and induce concomitant transcriptional down-regulation. |
|---|
| Catalog Num | A19514 |
|---|---|
| Formula | C19H11F4N3OS2 |
| Molecular Weight | 437.43 |
| CAS Number | 313380-27-7 |
| SMILES | O=C(C1=C(N)C2=C(C(F)(F)F)C=C(C3=CC=CS3)N=C2S1)NC4=CC=C(F)C=C4 |
| Synonyms | FDI 6; FDI6; NCGC00099374; NCGC-00099374; NCGC 00099374 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (192.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.86 mL | 114.3 mL | 228.61 mL |
| 0.5 mM | 4.57 mL | 22.86 mL | 45.72 mL |
| 1 mM | 2.29 mL | 11.43 mL | 22.86 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.57 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
