Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fexaramine is a small molecule farnesoid X receptor (FXR) agonist with 100-fold increased affinity relative to natural compounds. |
|---|
| Catalog Num | A21771 |
|---|---|
| Formula | C32H36N2O3 |
| Molecular Weight | 496.64 |
| CAS Number | 574013-66-4 |
| SMILES | CN(C)C1=CC=C(C2=CC=C(CN(C3=CC(/C=C/C(OC)=O)=CC=C3)C(C4CCCCC4)=O)C=C2)C=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (179.2 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.14 mL | 100.68 mL | 201.35 mL |
| 0.5 mM | 4.03 mL | 20.14 mL | 40.27 mL |
| 1 mM | 2.01 mL | 10.07 mL | 20.14 mL |
| 5 mM | 0.4 mL | 2.01 mL | 4.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
