Loading distributor info...
| Description | Firsocostat (ND-630; GS-0976; NDI-010976) is an acetyl-CoA carboxylase (ACC) inhibitor; inhibits human ACC1 and ACC2 with IC50 values of 2.1 and 6.1 nM, respectively. |
|---|
| Catalog Num | A21000 |
|---|---|
| Formula | C28H31N3O8S |
| Molecular Weight | 569.63 |
| CAS Number | 1434635-54-7 |
| SMILES | O=C(C(C(C)=C(C1=NC=CO1)S2)=C2N3C[C@H](OC4CCOCC4)C5=C(OC)C=CC=C5)N(C(C)(C)C(O)=O)C3=O |
| Synonyms | ND-630, ND630, ND 630; GS-0976, GS0976, GS 0976; NDI-010976, NDI010976, NDI 010976 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (154.48 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.56 mL | 87.78 mL | 175.55 mL |
| 0.5 mM | 3.51 mL | 17.56 mL | 35.11 mL |
| 1 mM | 1.76 mL | 8.78 mL | 17.56 mL |
| 5 mM | 0.35 mL | 1.76 mL | 3.51 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
