Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fluvastatin sodium (XU 62320) is a first fully synthetic, competitive HMG-CoA reductase inhibitor with an IC50 of 8 nM. |
|---|
| Catalog Num | A10403 |
|---|---|
| Formula | C24H25FNNaO4 |
| Molecular Weight | 433.45 |
| CAS Number | 93957-55-2 |
| SMILES | O=C([O-])C[C@H](O)C[C@H](O)/C=C/C(N1C(C)C)=C(C2=CC=C(F)C=C2)C3=C1C=CC=C3.[Na+] |
| Synonyms | XU 62-320 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 74 mg/mL (170.72 mM) | |
| Water | 1 mg/mL (2.3 mM) | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.07 mL | 115.35 mL | 230.71 mL |
| 0.5 mM | 4.61 mL | 23.07 mL | 46.14 mL |
| 1 mM | 2.31 mL | 11.54 mL | 23.07 mL |
| 5 mM | 0.46 mL | 2.31 mL | 4.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
