Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Fosfosal is a non-acetylated salicylic acid derivative that acts as an anti-inflammatory analgesic drug. |
|---|
| Catalog Num | A17753 |
|---|---|
| Formula | C7H7O6P |
| Molecular Weight | 218.1 |
| CAS Number | 6064-83-1 |
| SMILES | O=C(O)C1=CC=CC=C1OP(O)(O)=O |
| Synonyms | Fosfosal; Disdolen; Fosfosalum; Phosphonoxybenzoic acid; Salicyl phosphate; UR 1521; UR-1521; UR1521; UR 1522; UR-1522; UR1522; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 37 mg/mL (169.64 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 45.85 mL | 229.25 mL | 458.51 mL |
| 0.5 mM | 9.17 mL | 45.85 mL | 91.7 mL |
| 1 mM | 4.59 mL | 22.93 mL | 45.85 mL |
| 5 mM | 0.92 mL | 4.59 mL | 9.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
