Loading distributor info...
| Description | Fumonisin B4 is a derivative of fumonisin. Fumonisin B4 has low albumin binding capacity. |
|---|
| Catalog Num | A24589 |
|---|---|
| Formula | C34H59NO13 |
| Molecular Weight | 689.83 |
| CAS Number | 136379-60-7 |
| SMILES | C[C@H](CCCC)[C@@H](OC(C[C@H](C(O)=O)CC(O)=O)=O)[C@H](C[C@@H](C)CCCCCCCC[C@H](O)[C@@H](N)C)OC(C[C@H](C(O)=O)CC(O)=O)=O |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
