Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Gambogic acid is a natural product isolated from the Garcinia hanburyi tree. Gambogic Acid activates caspases with EC50 of 0.78-1.64 μM and competitively inhibits Bcl-XL, Bcl-2, Bcl-W, Bcl-B, Bfl-1 and Mcl-1 with IC50 of 1.47, 1.21, 2.02, 0.66, 1.06 and 0.79 μM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11988 |
|---|---|
| Formula | C38H44O8 |
| Molecular Weight | 628.75 |
| CAS Number | 2752-65-0 |
| SMILES | CC(=CCC[C@@]1(C=CC2=C(O1)C(=C3C(=C2O)C(=O)C4=C[C@@H]5C[C@@H]6[C@@]4(O3)[C@](C5=O)(OC6(C)C)C/C=C(/C)\C(=O)O)CC=C(C)C)C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 97 mg/mL (154.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 97 mg/mL (154.27 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 15.9 mL | 79.52 mL | 159.05 mL |
| 0.5 mM | 3.18 mL | 15.9 mL | 31.81 mL |
| 1 mM | 1.59 mL | 7.95 mL | 15.9 mL |
| 5 mM | 0.32 mL | 1.59 mL | 3.18 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
