Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GDC-0084 is a phosphatidylinositol 3-kinase (PI3K) inhibitor with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16272 |
|---|---|
| Formula | C18H22N8O2 |
| Molecular Weight | 382.428 |
| CAS Number | 1382979-44-3 |
| SMILES | NC1=NC=C(C2=NC(N3CCOCC3)=C4N=C(C(C)(C)OCC5)N5C4=N2)C=N1 |
| Synonyms | RG7666 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 8 mg/mL (20.91 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.15 mL | 130.74 mL | 261.49 mL |
| 0.5 mM | 5.23 mL | 26.15 mL | 52.3 mL |
| 1 mM | 2.61 mL | 13.07 mL | 26.15 mL |
| 5 mM | 0.52 mL | 2.61 mL | 5.23 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
