Loading distributor info...
| Description | GJ-103 is an active analog of the read-through compound GJ072. CAS: 1459687-96-7 (Sodium salt) 1459687-89-8 (Free Acid) |
|---|
| Catalog Num | A17164 |
|---|---|
| Formula | C16H14N4O3S |
| Molecular Weight | 342.37 |
| CAS Number | 1459687-89-8 |
| SMILES | O=C(O)CSC1=NN=C(C2=NC=CC=C2)N1C3=CC=CC(OC)=C3 |
| Synonyms | GJ103, GJ 103 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (178.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.21 mL | 146.04 mL | 292.08 mL |
| 0.5 mM | 5.84 mL | 29.21 mL | 58.42 mL |
| 1 mM | 2.92 mL | 14.6 mL | 29.21 mL |
| 5 mM | 0.58 mL | 2.92 mL | 5.84 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
