Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Glecaprevir, also known as ABT-493 and A-1282576, is a novel HCV NS3/4A protease inhibitor, with IC50 values ranging from 3.5 to 11.3 nM. |
|---|
| Catalog Num | A16948 |
|---|---|
| Formula | C38H46F4N6O9S |
| Molecular Weight | 838.87 |
| CAS Number | 1365970-03-1 |
| SMILES | O=C([C@H]1N(C2)C([C@H](C(C)(C)C)NC(O[C@@](CCC3)([H])[C@]3([H])OC/C=C/C(F)(F)C4=NC5=CC=CC=C5N=C4O[C@]2([H])C1)=O)=O)N[C@@]6(C(NS(=O)(C7(C)CC7)=O)=O)[C@H](C(F)F)C6 |
| Synonyms | ABT-493, ABT493, ABT 493, A-1282576, A1282576, A 1282576 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 99 mg/mL (118.01 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 11.92 mL | 59.6 mL | 119.21 mL |
| 0.5 mM | 2.38 mL | 11.92 mL | 23.84 mL |
| 1 mM | 1.19 mL | 5.96 mL | 11.92 mL |
| 5 mM | 0.24 mL | 1.19 mL | 2.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
