Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GLPG1837 is a potent and reversible CFTR potentiator, with EC50s of 3 nM and 339 nM for F508del and G551D CFTR, respectively. |
|---|
| Catalog Num | A19522 |
|---|---|
| Formula | C16H20N4O3S |
| Molecular Weight | 348.42 |
| CAS Number | 1654725-02-6 |
| SMILES | O=C(C1=NNC=C1)NC(S2)=C(C(N)=O)C3=C2C(C)(C)OC(C)(C)C3 |
| Synonyms | GLPG 1837, GLPG-1837; ABBV-974, ABBV 974, ABBV974 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (195.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.7 mL | 143.5 mL | 287.01 mL |
| 0.5 mM | 5.74 mL | 28.7 mL | 57.4 mL |
| 1 mM | 2.87 mL | 14.35 mL | 28.7 mL |
| 5 mM | 0.57 mL | 2.87 mL | 5.74 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
