Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Griseofulvin(Gris-PEG; Grifulvin) is a spirocyclic fungal natural product used in treatment of fungal dermatophytes; Antifungal drug. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16562 |
|---|---|
| Formula | C17H17ClO6 |
| Molecular Weight | 352.77 |
| CAS Number | 126-07-8 |
| SMILES | O=C1[C@]2(C(OC)=CC(C[C@H]2C)=O)OC3=C(Cl)C(OC)=CC(OC)=C13 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (138.9 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.35 mL | 141.74 mL | 283.47 mL |
| 0.5 mM | 5.67 mL | 28.35 mL | 56.69 mL |
| 1 mM | 2.83 mL | 14.17 mL | 28.35 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.67 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
