Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GS-444217 is a potent, orally available and selective ATP-competitive inhibitor of apoptosis signal-regulating kinase 1 (ASK1) with an IC50 of 2.87 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20517 |
|---|---|
| Formula | C23H21N7O |
| Molecular Weight | 411.46 |
| CAS Number | 1262041-49-5 |
| SMILES | O=C(C1=NC=CC(N2C=C(C3CC3)N=C2)=C1)NC4=CC=CC(C5=NN=CN5C6CC6)=C4 |
| Synonyms | GS444217, GS 444217 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 55 mg/mL (133.67 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.3 mL | 121.52 mL | 243.04 mL |
| 0.5 mM | 4.86 mL | 24.3 mL | 48.61 mL |
| 1 mM | 2.43 mL | 12.15 mL | 24.3 mL |
| 5 mM | 0.49 mL | 2.43 mL | 4.86 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
