Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK-2881078 is a selective androgen receptor modulator (SARM) that is being evaluated for effects on muscle growth and strength in subjects with muscle wasting to improve their physical function. |
|---|
| Catalog Num | A12645 |
|---|---|
| Formula | C14H15F3N2O2S |
| Molecular Weight | 332.3412 |
| CAS Number | 1539314-06-1 |
| SMILES | N#CC1=C(C(F)(F)F)C2=C(N([C@H](C)CS(=O)(C)=O)CC2)C=C1 |
| Synonyms | GSK2881078, GSK 2881078 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (169.53 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 43 mg/mL (130.17 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.09 mL | 150.45 mL | 300.9 mL |
| 0.5 mM | 6.02 mL | 30.09 mL | 60.18 mL |
| 1 mM | 3.01 mL | 15.04 mL | 30.09 mL |
| 5 mM | 0.6 mL | 3.01 mL | 6.02 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
