Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK-923295, is a small-molecule inhibitor of the mitotic kinesin centromere-associated protein E, (CENP-E). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11435 |
|---|---|
| Formula | C32H38ClN5O4 |
| Molecular Weight | 592.13 |
| CAS Number | 1088965-37-0 |
| SMILES | C[C@@H](C1=CC=CN2C1=NC(=C2)C3=CC=C(C=C3)C[C@@H](CNC(=O)CN(C)C)NC(=O)C4=CC(=C(C=C4)OC(C)C)Cl)O |
| Synonyms | GSK923295, GSK 923295 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (151.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 90 mg/mL (151.99 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.89 mL | 84.44 mL | 168.88 mL |
| 0.5 mM | 3.38 mL | 16.89 mL | 33.78 mL |
| 1 mM | 1.69 mL | 8.44 mL | 16.89 mL |
| 5 mM | 0.34 mL | 1.69 mL | 3.38 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
