Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | GSK-LSD1 dihydrochloride is a potent, selective and irreversible lysine specific demethylase 1 (LSD1) inhibitor with an IC50 of 16 nM. |
|---|
| Catalog Num | A21815 |
|---|---|
| Formula | C14H22Cl2N2 |
| Molecular Weight | 289.24 |
| CAS Number | 2102933-95-7 |
| SMILES | C1(N[C@H]2[C@H](C3=CC=CC=C3)C2)CCNCC1.Cl.Cl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 56 mg/mL (193.6 mM) | |
| Water | Warmed: 56 mg/mL (193.6 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.57 mL | 172.87 mL | 345.73 mL |
| 0.5 mM | 6.91 mL | 34.57 mL | 69.15 mL |
| 1 mM | 3.46 mL | 17.29 mL | 34.57 mL |
| 5 mM | 0.69 mL | 3.46 mL | 6.91 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
