Signaling Pathway
GSK1070916 is a potent Aurora B/C kinase inhibitor (with IC50 of 3.5 nM/6.5 nM) with broad antitumor activity in tissue culture cells and human tumor xenograft models.
Important Notice: For research use only. We do not sell to patients.
| Discription | GSK1070916 is a potent Aurora B/C kinase inhibitor (with IC50 of 3.5 nM/6.5 nM) with broad antitumor activity in tissue culture cells and human tumor xenograft models. |
|||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11168 |
|---|---|
| Formula | C30H33N7O |
| Molecular Weight | 507.63 |
| CAS Number | 942918-07-2 |
| SMILES | CCN1C=C(C(=N1)C2=CC=C(C=C2)NC(=O)N(C)C)C3=C4C=C(NC4=NC=C3)C5=CC(=CC=C5)CN(C)C |
| Synonyms | GSK-1070916 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 91 mg/mL (179.26 mM) | |
| Water | Insoluble | ||
| Ethanol | 8 mg/mL (15.75 mM) | ||
| In vivo | 2% Cremophor EL, 2% N,N-dimethylacetamide, pH 5.0 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.7 mL | 98.5 mL | 196.99 mL |
| 0.5 mM | 3.94 mL | 19.7 mL | 39.4 mL |
| 1 mM | 1.97 mL | 9.85 mL | 19.7 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.94 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
