Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK180736A is a G protein-coupled receptor kinase 2 (GRK2) inhibitor with an IC50 of 0.77 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20736 |
|---|---|
| Formula | C19H16FN5O2 |
| Molecular Weight | 365.36 |
| CAS Number | 817194-38-0 |
| SMILES | CC(N1)=C(C(NC2=CC=C(NN=C3)C3=C2)=O)C(C4=CC=C(F)C=C4)NC1=O |
| Synonyms | GSK-180736A; GSK 180736A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 66 mg/mL (180.64 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 3 mg/mL (8.21 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.37 mL | 136.85 mL | 273.7 mL |
| 0.5 mM | 5.47 mL | 27.37 mL | 54.74 mL |
| 1 mM | 2.74 mL | 13.69 mL | 27.37 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
